C11H21O3P — CID 21448852
2-cyclohexyloxy-5,5-dimethyl-1,3,2-dioxaphosphinane (PubChem CID 21448852) has the molecular formula C11H21O3P and a molecular weight of 232.26 g/mol. Its IUPAC name is 2-cyclohexyloxy-5,5-dimethyl-1,3,2-dioxaphosphinane.
| Compound Name | 2-cyclohexyloxy-5,5-dimethyl-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 21448852 |
| Molecular Formula | C11H21O3P |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-cyclohexyloxy-5,5-dimethyl-1,3,2-dioxaphosphinane |
| SMILES | CC1(C)COP(OC2CCCCC2)OC1 |
| InChI | InChI=1S/C11H21O3P/c1-11(2)8-12-15(13-9-11)14-10-6-4-3-5-7-10/h10H,3-9H2,1-2H3 |
| InChIKey | CQYJDCFMMUXMFB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|