C10H19O3P — CID 21448936
2-cyclopentyloxy-5,5-dimethyl-1,3,2-dioxaphosphinane (PubChem CID 21448936) has the molecular formula C10H19O3P and a molecular weight of 218.23 g/mol. Its IUPAC name is 2-cyclopentyloxy-5,5-dimethyl-1,3,2-dioxaphosphinane.
| Compound Name | 2-cyclopentyloxy-5,5-dimethyl-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 21448936 |
| Molecular Formula | C10H19O3P |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-cyclopentyloxy-5,5-dimethyl-1,3,2-dioxaphosphinane |
| SMILES | CC1(C)COP(OC2CCCC2)OC1 |
| InChI | InChI=1S/C10H19O3P/c1-10(2)7-11-14(12-8-10)13-9-5-3-4-6-9/h9H,3-8H2,1-2H3 |
| InChIKey | ZRCUYTKUQCSZLL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|