C54H96O6P2 — CID 143459144
9-[2,4-bis(2-cyclohexylpropan-2-yl)cycloheptyl]oxy-3-[2,4-bis(2-cyclohexylpropan-2-yl)cyclohexyl]oxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 143459144) has the molecular formula C54H96O6P2 and a molecular weight of 903.30 g/mol. Its IUPAC name is 9-[2,4-bis(2-cyclohexylpropan-2-yl)cycloheptyl]oxy-3-[2,4-bis(2-cyclohexylpropan-2-yl)cyclohexyl]oxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 9-[2,4-bis(2-cyclohexylpropan-2-yl)cycloheptyl]oxy-3-[2,4-bis(2-cyclohexylpropan-2-yl)cyclohexyl]oxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 143459144 |
| Molecular Formula | C54H96O6P2 |
| Molecular Weight | 903.30 g/mol |
| Exact Mass | 902.67 |
| IUPAC Name | 9-[2,4-bis(2-cyclohexylpropan-2-yl)cycloheptyl]oxy-3-[2,4-bis(2-cyclohexylpropan-2-yl)cyclohexyl]oxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | CC(C)(C1CCCCC1)C1CCCC(OP2OCC3(CO2)COP(OC2CCC(C(C)(C)C4CCCCC4)CC2C(C)(C)C2CCCCC2)OC3)C(C(C)(C)C2CCCCC2)C1 |
| InChI | InChI=1S/C54H96O6P2/c1-50(2,40-22-13-9-14-23-40)44-30-21-31-48(46(34-44)52(5,6)42-26-17-11-18-27-42)59-61-55-36-54(37-56-61)38-57-62(58-39-54)60-49-33-32-45(51(3,4)41-24-15-10-16-25-41)35-47(49)53(7,8)43-28-19-12-20-29-43/h40-49H,9-39H2,1-8H3 |
| InChIKey | GNZQTUSILJUREX-UHFFFAOYSA-N |
| XLogP | 16.94 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.30 |
| LogP ≤ 5 | 16.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|