C25H44O12P4 — CID 22899554
9-hydroxy-3-[4-[2-[4-[(9-hydroxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecan-3-yl)oxy]cyclohexyl]propan-2-yl]cyclohexyl]oxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 22899554) has the molecular formula C25H44O12P4 and a molecular weight of 660.51 g/mol. Its IUPAC name is 9-hydroxy-3-[4-[2-[4-[(9-hydroxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecan-3-yl)oxy]cyclohexyl]propan-2-yl]cyclohexyl]oxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 9-hydroxy-3-[4-[2-[4-[(9-hydroxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecan-3-yl)oxy]cyclohexyl]propan-2-yl]cyclohexyl]oxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 22899554 |
| Molecular Formula | C25H44O12P4 |
| Molecular Weight | 660.51 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | 9-hydroxy-3-[4-[2-[4-[(9-hydroxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecan-3-yl)oxy]cyclohexyl]propan-2-yl]cyclohexyl]oxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | CC(C)(C1CCC(OP2OCC3(COP(O)OC3)CO2)CC1)C1CCC(OP2OCC3(COP(O)OC3)CO2)CC1 |
| InChI | InChI=1S/C25H44O12P4/c1-23(2,19-3-7-21(8-4-19)36-40-32-15-24(16-33-40)11-28-38(26)29-12-24)20-5-9-22(10-6-20)37-41-34-17-25(18-35-41)13-30-39(27)31-14-25/h19-22,26-27H,3-18H2,1-2H3 |
| InChIKey | FUNAZLJYSMBLDH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|