C17H30O6P2 — CID 22899546
3,9-dicyclohexyloxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane (PubChem CID 22899546) has the molecular formula C17H30O6P2 and a molecular weight of 392.37 g/mol. Its IUPAC name is 3,9-dicyclohexyloxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane.
| Compound Name | 3,9-dicyclohexyloxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 22899546 |
| Molecular Formula | C17H30O6P2 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 3,9-dicyclohexyloxy-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| SMILES | C1CCC(OP2OCC3(CO2)COP(OC2CCCCC2)OC3)CC1 |
| InChI | InChI=1S/C17H30O6P2/c1-3-7-15(8-4-1)22-24-18-11-17(12-19-24)13-20-25(21-14-17)23-16-9-5-2-6-10-16/h15-16H,1-14H2 |
| InChIKey | IVUCJUPDYQUWDV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|