C43H58O10 — CID 140536586
[6,8-di(heptanoyl)-3-heptanoyloxy-7-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-5-yl] heptanoate (PubChem CID 140536586) has the molecular formula C43H58O10 and a molecular weight of 734.93 g/mol. Its IUPAC name is [6,8-di(heptanoyl)-3-heptanoyloxy-7-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-5-yl] heptanoate.
| Compound Name | [6,8-di(heptanoyl)-3-heptanoyloxy-7-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-5-yl] heptanoate |
|---|---|
| PubChem CID | 140536586 |
| Molecular Formula | C43H58O10 |
| Molecular Weight | 734.93 g/mol |
| Exact Mass | 734.40 |
| IUPAC Name | [6,8-di(heptanoyl)-3-heptanoyloxy-7-hydroxy-2-(4-hydroxyphenyl)-4-oxochromen-5-yl] heptanoate |
| SMILES | CCCCCCC(=O)Oc1c(-c2ccc(O)cc2)oc2c(C(=O)CCCCCC)c(O)c(C(=O)CCCCCC)c(OC(=O)CCCCCC)c2c1=O |
| InChI | InChI=1S/C43H58O10/c1-5-9-13-17-21-31(45)35-38(49)36(32(46)22-18-14-10-6-2)42-37(41(35)51-33(47)23-19-15-11-7-3)39(50)43(52-34(48)24-20-16-12-8-4)40(53-42)29-25-27-30(44)28-26-29/h25-28,44,49H,5-24H2,1-4H3 |
| InChIKey | SFUOAUMJVZGQAZ-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.93 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|