C45H60O12 — CID 68940706
[2-(3,4-dihydroxyphenyl)-6,8-di(hexanoyl)-3,7-di(hexanoyloxy)-4-oxochromen-5-yl] hexanoate (PubChem CID 68940706) has the molecular formula C45H60O12 and a molecular weight of 792.96 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-6,8-di(hexanoyl)-3,7-di(hexanoyloxy)-4-oxochromen-5-yl] hexanoate.
| Compound Name | [2-(3,4-dihydroxyphenyl)-6,8-di(hexanoyl)-3,7-di(hexanoyloxy)-4-oxochromen-5-yl] hexanoate |
|---|---|
| PubChem CID | 68940706 |
| Molecular Formula | C45H60O12 |
| Molecular Weight | 792.96 g/mol |
| Exact Mass | 792.41 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-6,8-di(hexanoyl)-3,7-di(hexanoyloxy)-4-oxochromen-5-yl] hexanoate |
| SMILES | CCCCCC(=O)Oc1c(C(=O)CCCCC)c(OC(=O)CCCCC)c2c(=O)c(OC(=O)CCCCC)c(-c3ccc(O)c(O)c3)oc2c1C(=O)CCCCC |
| InChI | InChI=1S/C45H60O12/c1-6-11-16-21-31(47)37-42(54-34(50)23-18-13-8-3)38(32(48)22-17-12-7-2)44-39(43(37)55-35(51)24-19-14-9-4)40(53)45(56-36(52)25-20-15-10-5)41(57-44)29-26-27-30(46)33(49)28-29/h26-28,46,49H,6-25H2,1-5H3 |
| InChIKey | NBFKCEJUJJQYHO-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 183.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.96 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|