C88H138O12 — CID 102108864
[4-[5-formyloxy-3,7-bis[[(Z)-octadec-9-enoyl]oxy]-4-oxochromen-2-yl]-2-[(Z)-octadec-9-enoyl]oxyphenyl] (Z)-octadec-9-enoate (PubChem CID 102108864) has the molecular formula C88H138O12 and a molecular weight of 1388.06 g/mol. Its IUPAC name is [4-[5-formyloxy-3,7-bis[[(Z)-octadec-9-enoyl]oxy]-4-oxochromen-2-yl]-2-[(Z)-octadec-9-enoyl]oxyphenyl] (Z)-octadec-9-enoate.
| Compound Name | [4-[5-formyloxy-3,7-bis[[(Z)-octadec-9-enoyl]oxy]-4-oxochromen-2-yl]-2-[(Z)-octadec-9-enoyl]oxyphenyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 102108864 |
| Molecular Formula | C88H138O12 |
| Molecular Weight | 1388.06 g/mol |
| Exact Mass | 1387.02 |
| IUPAC Name | [4-[5-formyloxy-3,7-bis[[(Z)-octadec-9-enoyl]oxy]-4-oxochromen-2-yl]-2-[(Z)-octadec-9-enoyl]oxyphenyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Oc1cc(OC=O)c2c(=O)c(OC(=O)CCCCCCC/C=C\CCCCCCCC)c(-c3ccc(OC(=O)CCCCCCC/C=C\CCCCCCCC)c(OC(=O)CCCCCCC/C=C\CCCCCCCC)c3)oc2c1 |
| InChI | InChI=1S/C88H138O12/c1-5-9-13-17-21-25-29-33-37-41-45-49-53-57-61-65-81(90)96-76-72-79(95-74-89)85-80(73-76)99-87(88(86(85)94)100-84(93)68-64-60-56-52-48-44-40-36-32-28-24-20-16-12-8-4)75-69-70-77(97-82(91)66-62-58-54-50-46-42-38-34-30-26-22-18-14-10-6-2)78(71-75)98-83(92)67-63-59-55-51-47-43-39-35-31-27-23-19-15-11-7-3/h33-40,69-74H,5-32,41-68H2,1-4H3/b37-33-,38-34-,39-35-,40-36- |
| InChIKey | JBKRWLIDPBKZOQ-PMDAXIHYSA-N |
| XLogP | 26.77 |
| TPSA | 161.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 67 |
| Heavy Atoms | 100 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1388.06 |
| LogP ≤ 5 | 26.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|