C12H8N4O2 — CID 140536959
1,4,5,11-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-2(7),3,8,12,14-pentaene-6,10-dione (PubChem CID 140536959) has the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 1,4,5,11-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-2(7),3,8,12,14-pentaene-6,10-dione.
| Compound Name | 1,4,5,11-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-2(7),3,8,12,14-pentaene-6,10-dione |
|---|---|
| PubChem CID | 140536959 |
| Molecular Formula | C12H8N4O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1,4,5,11-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-2(7),3,8,12,14-pentaene-6,10-dione |
| SMILES | O=C1c2cc3c(=O)[nH]ncc3n2Cc2cccn21 |
| InChI | InChI=1S/C12H8N4O2/c17-11-8-4-9-12(18)15-3-1-2-7(15)6-16(9)10(8)5-13-14-11/h1-5H,6H2,(H,14,17) |
| InChIKey | BULBEFNUFIQMLV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |