C8H9N3O — CID 141180271
1-ethyl-5H-pyrrolo[2,3-d]pyridazin-4-one (PubChem CID 141180271) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 1-ethyl-5H-pyrrolo[2,3-d]pyridazin-4-one.
| Compound Name | 1-ethyl-5H-pyrrolo[2,3-d]pyridazin-4-one |
|---|---|
| PubChem CID | 141180271 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 1-ethyl-5H-pyrrolo[2,3-d]pyridazin-4-one |
| SMILES | CCn1ccc2c(=O)[nH]ncc21 |
| InChI | InChI=1S/C8H9N3O/c1-2-11-4-3-6-7(11)5-9-10-8(6)12/h3-5H,2H2,1H3,(H,10,12) |
| InChIKey | KSRXJHFEZFAZRZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |