C11H15N3O — CID 145188289
ethane;2-ethyl-6H-pyrido[2,3-d]pyridazin-5-one (PubChem CID 145188289) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is ethane;2-ethyl-6H-pyrido[2,3-d]pyridazin-5-one.
| Compound Name | ethane;2-ethyl-6H-pyrido[2,3-d]pyridazin-5-one |
|---|---|
| PubChem CID | 145188289 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | ethane;2-ethyl-6H-pyrido[2,3-d]pyridazin-5-one |
| SMILES | CC.CCc1ccc2c(=O)[nH]ncc2n1 |
| InChI | InChI=1S/C9H9N3O.C2H6/c1-2-6-3-4-7-8(11-6)5-10-12-9(7)13;1-2/h3-5H,2H2,1H3,(H,12,13);1-2H3 |
| InChIKey | LPPSUPHLLOZLHO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |