C6H5N5O — CID 175953367
2-amino-6H-pyrimido[4,5-d]pyridazin-5-one (PubChem CID 175953367) has the molecular formula C6H5N5O and a molecular weight of 163.14 g/mol. Its IUPAC name is 2-amino-6H-pyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 2-amino-6H-pyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 175953367 |
| Molecular Formula | C6H5N5O |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 2-amino-6H-pyrimido[4,5-d]pyridazin-5-one |
| SMILES | Nc1ncc2c(=O)[nH]ncc2n1 |
| InChI | InChI=1S/C6H5N5O/c7-6-8-1-3-4(10-6)2-9-11-5(3)12/h1-2H,(H,11,12)(H2,7,8,10) |
| InChIKey | CEGKDRAINFIUOH-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |