C26H18F3N3O4 — CID 140539056
[2-[2-amino-4-[3-(1-benzofuran-2-yl)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 140539056) has the molecular formula C26H18F3N3O4 and a molecular weight of 493.44 g/mol. Its IUPAC name is [2-[2-amino-4-[3-(1-benzofuran-2-yl)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[2-amino-4-[3-(1-benzofuran-2-yl)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140539056 |
| Molecular Formula | C26H18F3N3O4 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | [2-[2-amino-4-[3-(1-benzofuran-2-yl)phenyl]-1-methyl-5-oxoimidazol-4-yl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | CN1C(=O)C(c2cccc(-c3cc4ccccc4o3)c2)(c2ccccc2OC(=O)C(F)(F)F)N=C1N |
| InChI | InChI=1S/C26H18F3N3O4/c1-32-22(33)25(31-24(32)30,18-10-3-5-12-20(18)36-23(34)26(27,28)29)17-9-6-8-15(13-17)21-14-16-7-2-4-11-19(16)35-21/h2-14H,1H3,(H2,30,31) |
| InChIKey | JDNILOYLMNUUBD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|