C22H16ClF3N4O6S — CID 140541101
2-[2-(3-chloro-5-isocyanophenoxy)-4-(trifluoromethoxy)phenoxy]-N-(2-methyl-6-sulfamoyl-3-pyridinyl)acetamide (PubChem CID 140541101) has the molecular formula C22H16ClF3N4O6S and a molecular weight of 556.91 g/mol. Its IUPAC name is 2-[2-(3-chloro-5-isocyanophenoxy)-4-(trifluoromethoxy)phenoxy]-N-(2-methyl-6-sulfamoyl-3-pyridinyl)acetamide.
| Compound Name | 2-[2-(3-chloro-5-isocyanophenoxy)-4-(trifluoromethoxy)phenoxy]-N-(2-methyl-6-sulfamoyl-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 140541101 |
| Molecular Formula | C22H16ClF3N4O6S |
| Molecular Weight | 556.91 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | 2-[2-(3-chloro-5-isocyanophenoxy)-4-(trifluoromethoxy)phenoxy]-N-(2-methyl-6-sulfamoyl-3-pyridinyl)acetamide |
| SMILES | [C-]#[N+]c1cc(Cl)cc(Oc2cc(OC(F)(F)F)ccc2OCC(=O)Nc2ccc(S(N)(=O)=O)nc2C)c1 |
| InChI | InChI=1S/C22H16ClF3N4O6S/c1-12-17(4-6-21(29-12)37(27,32)33)30-20(31)11-34-18-5-3-15(36-22(24,25)26)10-19(18)35-16-8-13(23)7-14(9-16)28-2/h3-10H,11H2,1H3,(H,30,31)(H2,27,32,33) |
| InChIKey | KKXWAWMPSMGYLW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 134.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.91 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|