C14H25NO2 — CID 140541177
[(3S,4S)-4-methylocta-1,7-dien-3-yl] N-tert-butylcarbamate (PubChem CID 140541177) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is [(3S,4S)-4-methylocta-1,7-dien-3-yl] N-tert-butylcarbamate.
| Compound Name | [(3S,4S)-4-methylocta-1,7-dien-3-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 140541177 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | [(3S,4S)-4-methylocta-1,7-dien-3-yl] N-tert-butylcarbamate |
| SMILES | C=CCC[C@H](C)[C@H](C=C)OC(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H25NO2/c1-7-9-10-11(3)12(8-2)17-13(16)15-14(4,5)6/h7-8,11-12H,1-2,9-10H2,3-6H3,(H,15,16)/t11-,12-/m0/s1 |
| InChIKey | XZNRNNZKRQZZFX-RYUDHWBXSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|