C20H28N4O3 — CID 140541502
2-[(5-hydroxy-2-adamantyl)-methylamino]-4-[(2S)-oxolan-2-yl]pyrimidine-5-carboxamide (PubChem CID 140541502) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[(5-hydroxy-2-adamantyl)-methylamino]-4-[(2S)-oxolan-2-yl]pyrimidine-5-carboxamide.
| Compound Name | 2-[(5-hydroxy-2-adamantyl)-methylamino]-4-[(2S)-oxolan-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 140541502 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 2-[(5-hydroxy-2-adamantyl)-methylamino]-4-[(2S)-oxolan-2-yl]pyrimidine-5-carboxamide |
| SMILES | CN(c1ncc(C(N)=O)c([C@@H]2CCCO2)n1)C1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C20H28N4O3/c1-24(17-12-5-11-6-13(17)9-20(26,7-11)8-12)19-22-10-14(18(21)25)16(23-19)15-3-2-4-27-15/h10-13,15,17,26H,2-9H2,1H3,(H2,21,25)/t11?,12?,13?,15-,17?,20?/m0/s1 |
| InChIKey | QSOQASOVFWUQIG-JYLFYUPZSA-N |
| XLogP | 1.80 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |