C22H32N4O3 — CID 140541505
4-cyclopentyl-2-[(5-hydroxy-2-adamantyl)-(2-hydroxyethyl)amino]pyrimidine-5-carboxamide (PubChem CID 140541505) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-cyclopentyl-2-[(5-hydroxy-2-adamantyl)-(2-hydroxyethyl)amino]pyrimidine-5-carboxamide.
| Compound Name | 4-cyclopentyl-2-[(5-hydroxy-2-adamantyl)-(2-hydroxyethyl)amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 140541505 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 4-cyclopentyl-2-[(5-hydroxy-2-adamantyl)-(2-hydroxyethyl)amino]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1cnc(N(CCO)C2C3CC4CC2CC(O)(C4)C3)nc1C1CCCC1 |
| InChI | InChI=1S/C22H32N4O3/c23-20(28)17-12-24-21(25-18(17)14-3-1-2-4-14)26(5-6-27)19-15-7-13-8-16(19)11-22(29,9-13)10-15/h12-16,19,27,29H,1-11H2,(H2,23,28) |
| InChIKey | GEBQRQYMNQMSHG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |