C21H33N3O2 — CID 143881495
adamantan-1-ol;4-(2,2-dimethylpropyl)-2-methylpyrimidine-5-carboxamide (PubChem CID 143881495) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is adamantan-1-ol;4-(2,2-dimethylpropyl)-2-methylpyrimidine-5-carboxamide.
| Compound Name | adamantan-1-ol;4-(2,2-dimethylpropyl)-2-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 143881495 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | adamantan-1-ol;4-(2,2-dimethylpropyl)-2-methylpyrimidine-5-carboxamide |
| SMILES | Cc1ncc(C(N)=O)c(CC(C)(C)C)n1.OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C11H17N3O.C10H16O/c1-7-13-6-8(10(12)15)9(14-7)5-11(2,3)4;11-10-4-7-1-8(5-10)3-9(2-7)6-10/h6H,5H2,1-4H3,(H2,12,15);7-9,11H,1-6H2 |
| InChIKey | ALLGXDUZQQPVSB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |