C25H44N6O2 — CID 140541869
(2-cyclohexyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-6-yl)-[3-[4-(1,3-diazinan-2-yl)piperazin-1-yl]azetidin-1-yl]methanone (PubChem CID 140541869) has the molecular formula C25H44N6O2 and a molecular weight of 460.67 g/mol. Its IUPAC name is (2-cyclohexyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-6-yl)-[3-[4-(1,3-diazinan-2-yl)piperazin-1-yl]azetidin-1-yl]methanone.
| Compound Name | (2-cyclohexyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-6-yl)-[3-[4-(1,3-diazinan-2-yl)piperazin-1-yl]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 140541869 |
| Molecular Formula | C25H44N6O2 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.35 |
| IUPAC Name | (2-cyclohexyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-6-yl)-[3-[4-(1,3-diazinan-2-yl)piperazin-1-yl]azetidin-1-yl]methanone |
| SMILES | O=C(C1CCC2NC(C3CCCCC3)OC2C1)N1CC(N2CCN(C3NCCCN3)CC2)C1 |
| InChI | InChI=1S/C25H44N6O2/c32-24(19-7-8-21-22(15-19)33-23(28-21)18-5-2-1-3-6-18)31-16-20(17-31)29-11-13-30(14-12-29)25-26-9-4-10-27-25/h18-23,25-28H,1-17H2 |
| InChIKey | DQAFZQCKQFFBAH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |