C24H39N3O4 — CID 162454840
[(3S)-4-(1-hydroxycyclopropanecarbonyl)-3-methylpiperazin-1-yl]-[4-(6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-2-yl)cyclohexyl]methanone (PubChem CID 162454840) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is [(3S)-4-(1-hydroxycyclopropanecarbonyl)-3-methylpiperazin-1-yl]-[4-(6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-2-yl)cyclohexyl]methanone.
| Compound Name | [(3S)-4-(1-hydroxycyclopropanecarbonyl)-3-methylpiperazin-1-yl]-[4-(6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-2-yl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 162454840 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | [(3S)-4-(1-hydroxycyclopropanecarbonyl)-3-methylpiperazin-1-yl]-[4-(6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazol-2-yl)cyclohexyl]methanone |
| SMILES | CC1CCC2NC(C3CCC(C(=O)N4CCN(C(=O)C5(O)CC5)[C@@H](C)C4)CC3)OC2C1 |
| InChI | InChI=1S/C24H39N3O4/c1-15-3-8-19-20(13-15)31-21(25-19)17-4-6-18(7-5-17)22(28)26-11-12-27(16(2)14-26)23(29)24(30)9-10-24/h15-21,25,30H,3-14H2,1-2H3/t15?,16-,17?,18?,19?,20?,21?/m0/s1 |
| InChIKey | UWGSEXQRTFSSDA-FSKQPPNESA-N |
| XLogP | 1.88 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |