C25H39N3O3 — CID 153420588
[4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]-[4-(2-methylidene-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)cyclohexyl]methanone (PubChem CID 153420588) has the molecular formula C25H39N3O3 and a molecular weight of 429.61 g/mol. Its IUPAC name is [4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]-[4-(2-methylidene-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)cyclohexyl]methanone.
| Compound Name | [4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]-[4-(2-methylidene-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 153420588 |
| Molecular Formula | C25H39N3O3 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | [4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]-[4-(2-methylidene-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-3-yl)cyclohexyl]methanone |
| SMILES | C=C1NC2CCCCC2CC1C1CCC(C(=O)N2CCN(C(=O)C3(O)CC3)CC2)CC1 |
| InChI | InChI=1S/C25H39N3O3/c1-17-21(16-20-4-2-3-5-22(20)26-17)18-6-8-19(9-7-18)23(29)27-12-14-28(15-13-27)24(30)25(31)10-11-25/h18-22,26,31H,1-16H2 |
| InChIKey | JCAASERAWMWMCS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |