C24H39N3O4 — CID 153420784
[4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-6-yl)-2-methoxycyclohexyl]-[4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]methanone (PubChem CID 153420784) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is [4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-6-yl)-2-methoxycyclohexyl]-[4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]methanone.
| Compound Name | [4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-6-yl)-2-methoxycyclohexyl]-[4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 153420784 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | [4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-6-yl)-2-methoxycyclohexyl]-[4-(1-hydroxycyclopropanecarbonyl)piperazin-1-yl]methanone |
| SMILES | COC1CC(C2CCC3CCNC3C2)CCC1C(=O)N1CCN(C(=O)C2(O)CC2)CC1 |
| InChI | InChI=1S/C24H39N3O4/c1-31-21-15-18(17-3-2-16-6-9-25-20(16)14-17)4-5-19(21)22(28)26-10-12-27(13-11-26)23(29)24(30)7-8-24/h16-21,25,30H,2-15H2,1H3 |
| InChIKey | CUXVFEQHNWNOHM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |