C29H49N3O2 — CID 153420654
[4-(7-tert-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)cyclohexyl]-[4-(1-methylcyclopropanecarbonyl)piperazin-1-yl]methanone (PubChem CID 153420654) has the molecular formula C29H49N3O2 and a molecular weight of 471.73 g/mol. Its IUPAC name is [4-(7-tert-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)cyclohexyl]-[4-(1-methylcyclopropanecarbonyl)piperazin-1-yl]methanone.
| Compound Name | [4-(7-tert-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)cyclohexyl]-[4-(1-methylcyclopropanecarbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 153420654 |
| Molecular Formula | C29H49N3O2 |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 471.38 |
| IUPAC Name | [4-(7-tert-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)cyclohexyl]-[4-(1-methylcyclopropanecarbonyl)piperazin-1-yl]methanone |
| SMILES | CC1(C(=O)N2CCN(C(=O)C3CCC(C4CCNC5CC(C(C)(C)C)CCC54)CC3)CC2)CC1 |
| InChI | InChI=1S/C29H49N3O2/c1-28(2,3)22-9-10-24-23(11-14-30-25(24)19-22)20-5-7-21(8-6-20)26(33)31-15-17-32(18-16-31)27(34)29(4)12-13-29/h20-25,30H,5-19H2,1-4H3 |
| InChIKey | PIUIFIPYFQCLRN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |