C26H44N4O — CID 153420736
[4-[1-[4-(1,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydroindazol-5-yl)cyclohexyl]ethenyl]piperazin-1-yl]-(1-methylcyclopropyl)methanone (PubChem CID 153420736) has the molecular formula C26H44N4O and a molecular weight of 428.67 g/mol. Its IUPAC name is [4-[1-[4-(1,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydroindazol-5-yl)cyclohexyl]ethenyl]piperazin-1-yl]-(1-methylcyclopropyl)methanone.
| Compound Name | [4-[1-[4-(1,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydroindazol-5-yl)cyclohexyl]ethenyl]piperazin-1-yl]-(1-methylcyclopropyl)methanone |
|---|---|
| PubChem CID | 153420736 |
| Molecular Formula | C26H44N4O |
| Molecular Weight | 428.67 g/mol |
| Exact Mass | 428.35 |
| IUPAC Name | [4-[1-[4-(1,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydroindazol-5-yl)cyclohexyl]ethenyl]piperazin-1-yl]-(1-methylcyclopropyl)methanone |
| SMILES | C=C(C1CCC(C2CCC3C(C2)C(C)NN3C)CC1)N1CCN(C(=O)C2(C)CC2)CC1 |
| InChI | InChI=1S/C26H44N4O/c1-18-23-17-22(9-10-24(23)28(4)27-18)21-7-5-20(6-8-21)19(2)29-13-15-30(16-14-29)25(31)26(3)11-12-26/h18,20-24,27H,2,5-17H2,1,3-4H3 |
| InChIKey | YDCVRCGVFBHFQE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |