C23H39N5O2 — CID 153420693
[4-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-b]pyridazin-6-yl)cyclohexyl]-[4-(1-methylcyclobutanecarbonyl)piperazin-1-yl]methanone (PubChem CID 153420693) has the molecular formula C23H39N5O2 and a molecular weight of 417.60 g/mol. Its IUPAC name is [4-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-b]pyridazin-6-yl)cyclohexyl]-[4-(1-methylcyclobutanecarbonyl)piperazin-1-yl]methanone.
| Compound Name | [4-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-b]pyridazin-6-yl)cyclohexyl]-[4-(1-methylcyclobutanecarbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 153420693 |
| Molecular Formula | C23H39N5O2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | [4-(1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-b]pyridazin-6-yl)cyclohexyl]-[4-(1-methylcyclobutanecarbonyl)piperazin-1-yl]methanone |
| SMILES | CC1(C(=O)N2CCN(C(=O)C3CCC(C4CCC5NCCN5N4)CC3)CC2)CCC1 |
| InChI | InChI=1S/C23H39N5O2/c1-23(9-2-10-23)22(30)27-15-13-26(14-16-27)21(29)18-5-3-17(4-6-18)19-7-8-20-24-11-12-28(20)25-19/h17-20,24-25H,2-16H2,1H3 |
| InChIKey | TUVANKBDOXLZAZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |