C25H42N4O3 — CID 153420738
[4-[1-(2-hydroxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindazol-5-yl]cyclohexyl]-[4-(1-methylcyclopropanecarbonyl)piperazin-1-yl]methanone (PubChem CID 153420738) has the molecular formula C25H42N4O3 and a molecular weight of 446.64 g/mol. Its IUPAC name is [4-[1-(2-hydroxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindazol-5-yl]cyclohexyl]-[4-(1-methylcyclopropanecarbonyl)piperazin-1-yl]methanone.
| Compound Name | [4-[1-(2-hydroxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindazol-5-yl]cyclohexyl]-[4-(1-methylcyclopropanecarbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 153420738 |
| Molecular Formula | C25H42N4O3 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | [4-[1-(2-hydroxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindazol-5-yl]cyclohexyl]-[4-(1-methylcyclopropanecarbonyl)piperazin-1-yl]methanone |
| SMILES | CC1(C(=O)N2CCN(C(=O)C3CCC(C4CCC5C(CNN5CCO)C4)CC3)CC2)CC1 |
| InChI | InChI=1S/C25H42N4O3/c1-25(8-9-25)24(32)28-12-10-27(11-13-28)23(31)19-4-2-18(3-5-19)20-6-7-22-21(16-20)17-26-29(22)14-15-30/h18-22,26,30H,2-17H2,1H3 |
| InChIKey | SVCSLLLJPWMMNM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |