C29H48N4O — CID 153420705
[4-[1-(cyclobutylmethyl)-2,3,3a,4,5,6,7,7a-octahydroindazol-5-yl]cyclohexyl]-[4-[1-(1-methylcyclopropyl)ethenyl]piperazin-1-yl]methanone (PubChem CID 153420705) has the molecular formula C29H48N4O and a molecular weight of 468.73 g/mol. Its IUPAC name is [4-[1-(cyclobutylmethyl)-2,3,3a,4,5,6,7,7a-octahydroindazol-5-yl]cyclohexyl]-[4-[1-(1-methylcyclopropyl)ethenyl]piperazin-1-yl]methanone.
| Compound Name | [4-[1-(cyclobutylmethyl)-2,3,3a,4,5,6,7,7a-octahydroindazol-5-yl]cyclohexyl]-[4-[1-(1-methylcyclopropyl)ethenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 153420705 |
| Molecular Formula | C29H48N4O |
| Molecular Weight | 468.73 g/mol |
| Exact Mass | 468.38 |
| IUPAC Name | [4-[1-(cyclobutylmethyl)-2,3,3a,4,5,6,7,7a-octahydroindazol-5-yl]cyclohexyl]-[4-[1-(1-methylcyclopropyl)ethenyl]piperazin-1-yl]methanone |
| SMILES | C=C(N1CCN(C(=O)C2CCC(C3CCC4C(CNN4CC4CCC4)C3)CC2)CC1)C1(C)CC1 |
| InChI | InChI=1S/C29H48N4O/c1-21(29(2)12-13-29)31-14-16-32(17-15-31)28(34)24-8-6-23(7-9-24)25-10-11-27-26(18-25)19-30-33(27)20-22-4-3-5-22/h22-27,30H,1,3-20H2,2H3 |
| InChIKey | BSNKJGXODCZSIY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.73 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |