C25H42N4O3 — CID 153420604
(1-hydroxycyclopropyl)-[4-[1-[4-[1-(2-hydroxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindazol-6-yl]cyclohexyl]ethenyl]piperazin-1-yl]methanone (PubChem CID 153420604) has the molecular formula C25H42N4O3 and a molecular weight of 446.64 g/mol. Its IUPAC name is (1-hydroxycyclopropyl)-[4-[1-[4-[1-(2-hydroxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindazol-6-yl]cyclohexyl]ethenyl]piperazin-1-yl]methanone.
| Compound Name | (1-hydroxycyclopropyl)-[4-[1-[4-[1-(2-hydroxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindazol-6-yl]cyclohexyl]ethenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 153420604 |
| Molecular Formula | C25H42N4O3 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | (1-hydroxycyclopropyl)-[4-[1-[4-[1-(2-hydroxyethyl)-2,3,3a,4,5,6,7,7a-octahydroindazol-6-yl]cyclohexyl]ethenyl]piperazin-1-yl]methanone |
| SMILES | C=C(C1CCC(C2CCC3CNN(CCO)C3C2)CC1)N1CCN(C(=O)C2(O)CC2)CC1 |
| InChI | InChI=1S/C25H42N4O3/c1-18(27-10-12-28(13-11-27)24(31)25(32)8-9-25)19-2-4-20(5-3-19)21-6-7-22-17-26-29(14-15-30)23(22)16-21/h19-23,26,30,32H,1-17H2 |
| InChIKey | FNXHOEFOTYCWQT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |