C24H40N4O2 — CID 153420644
[1-(1-aminocyclopropanecarbonyl)piperidin-4-yl]-[4-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindazol-6-yl)cyclohexyl]methanone (PubChem CID 153420644) has the molecular formula C24H40N4O2 and a molecular weight of 416.61 g/mol. Its IUPAC name is [1-(1-aminocyclopropanecarbonyl)piperidin-4-yl]-[4-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindazol-6-yl)cyclohexyl]methanone.
| Compound Name | [1-(1-aminocyclopropanecarbonyl)piperidin-4-yl]-[4-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindazol-6-yl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 153420644 |
| Molecular Formula | C24H40N4O2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | [1-(1-aminocyclopropanecarbonyl)piperidin-4-yl]-[4-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindazol-6-yl)cyclohexyl]methanone |
| SMILES | CN1NCC2CCC(C3CCC(C(=O)C4CCN(C(=O)C5(N)CC5)CC4)CC3)CC21 |
| InChI | InChI=1S/C24H40N4O2/c1-27-21-14-19(6-7-20(21)15-26-27)16-2-4-17(5-3-16)22(29)18-8-12-28(13-9-18)23(30)24(25)10-11-24/h16-21,26H,2-15,25H2,1H3 |
| InChIKey | QOSOJWUJIASYFY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |