C26H43N3O2 — CID 153420589
[4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)cyclohexyl]-[4-(1-methylcyclopropanecarbonyl)piperazin-1-yl]methanone (PubChem CID 153420589) has the molecular formula C26H43N3O2 and a molecular weight of 429.65 g/mol. Its IUPAC name is [4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)cyclohexyl]-[4-(1-methylcyclopropanecarbonyl)piperazin-1-yl]methanone.
| Compound Name | [4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)cyclohexyl]-[4-(1-methylcyclopropanecarbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 153420589 |
| Molecular Formula | C26H43N3O2 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.34 |
| IUPAC Name | [4-(6-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-2-yl)cyclohexyl]-[4-(1-methylcyclopropanecarbonyl)piperazin-1-yl]methanone |
| SMILES | CC1CCC2NC(C3CCC(C(=O)N4CCN(C(=O)C5(C)CC5)CC4)CC3)CCC2C1 |
| InChI | InChI=1S/C26H43N3O2/c1-18-3-9-23-21(17-18)8-10-22(27-23)19-4-6-20(7-5-19)24(30)28-13-15-29(16-14-28)25(31)26(2)11-12-26/h18-23,27H,3-17H2,1-2H3 |
| InChIKey | XWGGLICAGHJYHA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |