C22H37NO6Si — CID 140542185
tert-butyl N-[(3R)-1-(1,3-benzodioxol-5-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybutan-2-yl]carbamate (PubChem CID 140542185) has the molecular formula C22H37NO6Si and a molecular weight of 439.63 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(1,3-benzodioxol-5-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(1,3-benzodioxol-5-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 140542185 |
| Molecular Formula | C22H37NO6Si |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | tert-butyl N-[(3R)-1-(1,3-benzodioxol-5-yl)-3-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc2c(c1)OCO2)[C@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H37NO6Si/c1-21(2,3)28-20(25)23-16(19(13-24)29-30(7,8)22(4,5)6)11-15-9-10-17-18(12-15)27-14-26-17/h9-10,12,16,19,24H,11,13-14H2,1-8H3,(H,23,25)/t16?,19-/m0/s1 |
| InChIKey | IONCSOGQFRVZAH-CVMIBEPCSA-N |
| XLogP | 4.23 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|