C13H21NO4 — CID 140542835
tert-butyl 1-hydroxy-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxylate (PubChem CID 140542835) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is tert-butyl 1-hydroxy-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxylate.
| Compound Name | tert-butyl 1-hydroxy-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxylate |
|---|---|
| PubChem CID | 140542835 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | tert-butyl 1-hydroxy-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2C3CCC(O3)C2C1O |
| InChI | InChI=1S/C13H21NO4/c1-13(2,3)18-12(16)14-6-7-8-4-5-9(17-8)10(7)11(14)15/h7-11,15H,4-6H2,1-3H3 |
| InChIKey | RCQTXLWYPVGVCA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |