C20H36N4O3 — CID 140543695
N'-[(3S,5S)-5-(dimethylcarbamoyl)pyrrolidin-3-yl]-N'-(4,4-dimethylcyclohexyl)-2,2-dimethylpropanediamide (PubChem CID 140543695) has the molecular formula C20H36N4O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is N'-[(3S,5S)-5-(dimethylcarbamoyl)pyrrolidin-3-yl]-N'-(4,4-dimethylcyclohexyl)-2,2-dimethylpropanediamide.
| Compound Name | N'-[(3S,5S)-5-(dimethylcarbamoyl)pyrrolidin-3-yl]-N'-(4,4-dimethylcyclohexyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 140543695 |
| Molecular Formula | C20H36N4O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | N'-[(3S,5S)-5-(dimethylcarbamoyl)pyrrolidin-3-yl]-N'-(4,4-dimethylcyclohexyl)-2,2-dimethylpropanediamide |
| SMILES | CN(C)C(=O)[C@@H]1C[C@H](N(C(=O)C(C)(C)C(N)=O)C2CCC(C)(C)CC2)CN1 |
| InChI | InChI=1S/C20H36N4O3/c1-19(2)9-7-13(8-10-19)24(18(27)20(3,4)17(21)26)14-11-15(22-12-14)16(25)23(5)6/h13-15,22H,7-12H2,1-6H3,(H2,21,26)/t14-,15-/m0/s1 |
| InChIKey | CWCVCFSYGLVMPM-GJZGRUSLSA-N |
| XLogP | 1.11 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|