C15H23FN5O16P3 — CID 140543822
[[(2R,3S,4R,5R)-5-[1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iminopurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 140543822) has the molecular formula C15H23FN5O16P3 and a molecular weight of 641.29 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iminopurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-[1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iminopurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 140543822 |
| Molecular Formula | C15H23FN5O16P3 |
| Molecular Weight | 641.29 g/mol |
| Exact Mass | 641.03 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[1-[(2R,3S,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iminopurin-9-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | [H]/N=c1\c2ncn([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]3O)c2ncn1[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1F |
| InChI | InChI=1S/C15H23FN5O16P3/c16-7-9(23)5(1-22)34-14(7)20-4-19-13-8(12(20)17)18-3-21(13)15-11(25)10(24)6(35-15)2-33-39(29,30)37-40(31,32)36-38(26,27)28/h3-7,9-11,14-15,17,22-25H,1-2H2,(H,29,30)(H,31,32)(H2,26,27,28)/b17-12+/t5-,6-,7+,9-,10-,11-,14-,15-/m1/s1 |
| InChIKey | QZWZSWJOJTUQFZ-LBLPWUIFSA-N |
| XLogP | -2.74 |
| TPSA | 318.69 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.29 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|