C29H29N3O2S — CID 140544868
3-[3-[4-(benzenesulfonyl)-1-phenylpiperazin-2-yl]phenyl]-N-methylaniline (PubChem CID 140544868) has the molecular formula C29H29N3O2S and a molecular weight of 483.64 g/mol. Its IUPAC name is 3-[3-[4-(benzenesulfonyl)-1-phenylpiperazin-2-yl]phenyl]-N-methylaniline.
| Compound Name | 3-[3-[4-(benzenesulfonyl)-1-phenylpiperazin-2-yl]phenyl]-N-methylaniline |
|---|---|
| PubChem CID | 140544868 |
| Molecular Formula | C29H29N3O2S |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 3-[3-[4-(benzenesulfonyl)-1-phenylpiperazin-2-yl]phenyl]-N-methylaniline |
| SMILES | CNc1cccc(-c2cccc(C3CN(S(=O)(=O)c4ccccc4)CCN3c3ccccc3)c2)c1 |
| InChI | InChI=1S/C29H29N3O2S/c1-30-26-13-9-11-24(21-26)23-10-8-12-25(20-23)29-22-31(35(33,34)28-16-6-3-7-17-28)18-19-32(29)27-14-4-2-5-15-27/h2-17,20-21,29-30H,18-19,22H2,1H3 |
| InChIKey | DZUSZVYBSWIRJP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |