C25H40N4O2 — CID 140547491
(3S)-3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylmethyl)-N'-[(6-amino-2-methyl-3-pyridinyl)methyl]-2-propan-2-ylbutanediamide (PubChem CID 140547491) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is (3S)-3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylmethyl)-N'-[(6-amino-2-methyl-3-pyridinyl)methyl]-2-propan-2-ylbutanediamide.
| Compound Name | (3S)-3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylmethyl)-N'-[(6-amino-2-methyl-3-pyridinyl)methyl]-2-propan-2-ylbutanediamide |
|---|---|
| PubChem CID | 140547491 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | (3S)-3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylmethyl)-N'-[(6-amino-2-methyl-3-pyridinyl)methyl]-2-propan-2-ylbutanediamide |
| SMILES | Cc1nc(N)ccc1CNC(=O)[C@@H](CC1CCCC2CCCCC21)C(C(N)=O)C(C)C |
| InChI | InChI=1S/C25H40N4O2/c1-15(2)23(24(27)30)21(13-18-9-6-8-17-7-4-5-10-20(17)18)25(31)28-14-19-11-12-22(26)29-16(19)3/h11-12,15,17-18,20-21,23H,4-10,13-14H2,1-3H3,(H2,26,29)(H2,27,30)(H,28,31)/t17?,18?,20?,21-,23?/m0/s1 |
| InChIKey | LMJYIFKGIWKNFW-UMRCGLLGSA-N |
| XLogP | 3.96 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |