C25H41N5O2 — CID 59252953
(2R)-N-[(2S)-3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1-[(6-amino-3-pyridinyl)methylamino]-1-oxopropan-2-yl]-2-amino-3-methylpentanamide (PubChem CID 59252953) has the molecular formula C25H41N5O2 and a molecular weight of 443.64 g/mol. Its IUPAC name is (2R)-N-[(2S)-3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1-[(6-amino-3-pyridinyl)methylamino]-1-oxopropan-2-yl]-2-amino-3-methylpentanamide.
| Compound Name | (2R)-N-[(2S)-3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1-[(6-amino-3-pyridinyl)methylamino]-1-oxopropan-2-yl]-2-amino-3-methylpentanamide |
|---|---|
| PubChem CID | 59252953 |
| Molecular Formula | C25H41N5O2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.33 |
| IUPAC Name | (2R)-N-[(2S)-3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1-[(6-amino-3-pyridinyl)methylamino]-1-oxopropan-2-yl]-2-amino-3-methylpentanamide |
| SMILES | CCC(C)[C@@H](N)C(=O)N[C@@H](CC1CCCC2CCCCC21)C(=O)NCc1ccc(N)nc1 |
| InChI | InChI=1S/C25H41N5O2/c1-3-16(2)23(27)25(32)30-21(24(31)29-15-17-11-12-22(26)28-14-17)13-19-9-6-8-18-7-4-5-10-20(18)19/h11-12,14,16,18-21,23H,3-10,13,15,27H2,1-2H3,(H2,26,28)(H,29,31)(H,30,32)/t16?,18?,19?,20?,21-,23+/m0/s1 |
| InChIKey | FRDOQPBKGWUVOP-JEZIXGPTSA-N |
| XLogP | 3.13 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |