C28H38ClN5O2 — CID 67030069
(2R)-3-[(8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]-2-[[2-amino-3-(4-chlorophenyl)propanoyl]amino]-N-[(6-amino-3-pyridinyl)methyl]propanamide (PubChem CID 67030069) has the molecular formula C28H38ClN5O2 and a molecular weight of 512.10 g/mol. Its IUPAC name is (2R)-3-[(8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]-2-[[2-amino-3-(4-chlorophenyl)propanoyl]amino]-N-[(6-amino-3-pyridinyl)methyl]propanamide.
| Compound Name | (2R)-3-[(8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]-2-[[2-amino-3-(4-chlorophenyl)propanoyl]amino]-N-[(6-amino-3-pyridinyl)methyl]propanamide |
|---|---|
| PubChem CID | 67030069 |
| Molecular Formula | C28H38ClN5O2 |
| Molecular Weight | 512.10 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | (2R)-3-[(8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]-2-[[2-amino-3-(4-chlorophenyl)propanoyl]amino]-N-[(6-amino-3-pyridinyl)methyl]propanamide |
| SMILES | Nc1ccc(CNC(=O)[C@@H](CC2CCCC3CCCC[C@@H]32)NC(=O)C(N)Cc2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C28H38ClN5O2/c29-22-11-8-18(9-12-22)14-24(30)27(35)34-25(28(36)33-17-19-10-13-26(31)32-16-19)15-21-6-3-5-20-4-1-2-7-23(20)21/h8-13,16,20-21,23-25H,1-7,14-15,17,30H2,(H2,31,32)(H,33,36)(H,34,35)/t20?,21?,23-,24?,25+/m0/s1 |
| InChIKey | FHQFSCZWIZJLKX-CRGLHFRGSA-N |
| XLogP | 3.98 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.10 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |