C36H46F3IO5S2 — CID 140547792
8-iodooctyl 2-[bis(2-tert-butylphenyl)-(4-fluorophenyl)-λ4-sulfanyl]oxysulfonyl-2,2-difluoroacetate (PubChem CID 140547792) has the molecular formula C36H46F3IO5S2 and a molecular weight of 806.79 g/mol. Its IUPAC name is 8-iodooctyl 2-[bis(2-tert-butylphenyl)-(4-fluorophenyl)-λ4-sulfanyl]oxysulfonyl-2,2-difluoroacetate.
| Compound Name | 8-iodooctyl 2-[bis(2-tert-butylphenyl)-(4-fluorophenyl)-λ4-sulfanyl]oxysulfonyl-2,2-difluoroacetate |
|---|---|
| PubChem CID | 140547792 |
| Molecular Formula | C36H46F3IO5S2 |
| Molecular Weight | 806.79 g/mol |
| Exact Mass | 806.18 |
| IUPAC Name | 8-iodooctyl 2-[bis(2-tert-butylphenyl)-(4-fluorophenyl)-λ4-sulfanyl]oxysulfonyl-2,2-difluoroacetate |
| SMILES | CC(C)(C)c1ccccc1S(OS(=O)(=O)C(F)(F)C(=O)OCCCCCCCCI)(c1ccc(F)cc1)c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C36H46F3IO5S2/c1-34(2,3)29-17-11-13-19-31(29)46(28-23-21-27(37)22-24-28,32-20-14-12-18-30(32)35(4,5)6)45-47(42,43)36(38,39)33(41)44-26-16-10-8-7-9-15-25-40/h11-14,17-24H,7-10,15-16,25-26H2,1-6H3 |
| InChIKey | QMNWPXIMPZBSJT-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.79 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|