C31H31F3N4O9S — CID 140548493
methyl (E)-7,7,7-trifluoro-6-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]-2-[(4-nitrophenyl)sulfonylamino]hept-2-enoate (PubChem CID 140548493) has the molecular formula C31H31F3N4O9S and a molecular weight of 692.67 g/mol. Its IUPAC name is methyl (E)-7,7,7-trifluoro-6-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]-2-[(4-nitrophenyl)sulfonylamino]hept-2-enoate.
| Compound Name | methyl (E)-7,7,7-trifluoro-6-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]-2-[(4-nitrophenyl)sulfonylamino]hept-2-enoate |
|---|---|
| PubChem CID | 140548493 |
| Molecular Formula | C31H31F3N4O9S |
| Molecular Weight | 692.67 g/mol |
| Exact Mass | 692.18 |
| IUPAC Name | methyl (E)-7,7,7-trifluoro-6-[[(2S)-2-(methoxycarbonylamino)-3,3-diphenylpropanoyl]amino]-2-[(4-nitrophenyl)sulfonylamino]hept-2-enoate |
| SMILES | COC(=O)N[C@H](C(=O)NC(CC/C=C(/NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(=O)OC)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H31F3N4O9S/c1-46-29(40)24(37-48(44,45)23-18-16-22(17-19-23)38(42)43)14-9-15-25(31(32,33)34)35-28(39)27(36-30(41)47-2)26(20-10-5-3-6-11-20)21-12-7-4-8-13-21/h3-8,10-14,16-19,25-27,37H,9,15H2,1-2H3,(H,35,39)(H,36,41)/b24-14+/t25?,27-/m0/s1 |
| InChIKey | GPQVYRYCHBUJOD-FNNFQLTRSA-N |
| XLogP | 4.31 |
| TPSA | 183.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.67 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|