C26H34O7 — CID 140552180
2-[1-[3-butoxy-4-[2-(4-hydroxy-2-methoxyphenyl)ethoxy]phenyl]ethoxy]ethyl prop-2-enoate (PubChem CID 140552180) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is 2-[1-[3-butoxy-4-[2-(4-hydroxy-2-methoxyphenyl)ethoxy]phenyl]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[1-[3-butoxy-4-[2-(4-hydroxy-2-methoxyphenyl)ethoxy]phenyl]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 140552180 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 2-[1-[3-butoxy-4-[2-(4-hydroxy-2-methoxyphenyl)ethoxy]phenyl]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(C)c1ccc(OCCc2ccc(O)cc2OC)c(OCCCC)c1 |
| InChI | InChI=1S/C26H34O7/c1-5-7-13-31-25-17-21(19(3)30-15-16-33-26(28)6-2)9-11-23(25)32-14-12-20-8-10-22(27)18-24(20)29-4/h6,8-11,17-19,27H,2,5,7,12-16H2,1,3-4H3 |
| InChIKey | SWJHCGJHNNWOGP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|