C29H39FO8 — CID 140552182
2-[1-[3-butoxy-4-[2-[3-fluoro-4-(2-methoxyethoxymethoxy)phenyl]ethoxy]phenyl]ethoxy]ethyl prop-2-enoate (PubChem CID 140552182) has the molecular formula C29H39FO8 and a molecular weight of 534.62 g/mol. Its IUPAC name is 2-[1-[3-butoxy-4-[2-[3-fluoro-4-(2-methoxyethoxymethoxy)phenyl]ethoxy]phenyl]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[1-[3-butoxy-4-[2-[3-fluoro-4-(2-methoxyethoxymethoxy)phenyl]ethoxy]phenyl]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 140552182 |
| Molecular Formula | C29H39FO8 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 2-[1-[3-butoxy-4-[2-[3-fluoro-4-(2-methoxyethoxymethoxy)phenyl]ethoxy]phenyl]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(C)c1ccc(OCCc2ccc(OCOCCOC)c(F)c2)c(OCCCC)c1 |
| InChI | InChI=1S/C29H39FO8/c1-5-7-13-35-28-20-24(22(3)34-17-18-37-29(31)6-2)9-11-27(28)36-14-12-23-8-10-26(25(30)19-23)38-21-33-16-15-32-4/h6,8-11,19-20,22H,2,5,7,12-18,21H2,1,3-4H3 |
| InChIKey | KLXUOTLPJVMBSB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|