C28H37FO6 — CID 68602566
(E)-3-[3-butoxy-4-[2-(3-fluoro-4-pentoxyphenyl)ethoxy]phenyl]-2-ethoxyprop-2-enoic acid (PubChem CID 68602566) has the molecular formula C28H37FO6 and a molecular weight of 488.60 g/mol. Its IUPAC name is (E)-3-[3-butoxy-4-[2-(3-fluoro-4-pentoxyphenyl)ethoxy]phenyl]-2-ethoxyprop-2-enoic acid.
| Compound Name | (E)-3-[3-butoxy-4-[2-(3-fluoro-4-pentoxyphenyl)ethoxy]phenyl]-2-ethoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 68602566 |
| Molecular Formula | C28H37FO6 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | (E)-3-[3-butoxy-4-[2-(3-fluoro-4-pentoxyphenyl)ethoxy]phenyl]-2-ethoxyprop-2-enoic acid |
| SMILES | CCCCCOc1ccc(CCOc2ccc(/C=C(/OCC)C(=O)O)cc2OCCCC)cc1F |
| InChI | InChI=1S/C28H37FO6/c1-4-7-9-16-33-24-12-10-21(18-23(24)29)14-17-35-25-13-11-22(19-26(25)34-15-8-5-2)20-27(28(30)31)32-6-3/h10-13,18-20H,4-9,14-17H2,1-3H3,(H,30,31)/b27-20+ |
| InChIKey | MJMOKDYQSVWJFE-NHFJDJAPSA-N |
| XLogP | 6.66 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|