C25H31ClO6 — CID 68601187
(E)-3-[3-butoxy-4-[2-(3-chloro-4-ethoxyphenyl)ethoxy]phenyl]-2-ethoxyprop-2-enoic acid (PubChem CID 68601187) has the molecular formula C25H31ClO6 and a molecular weight of 462.97 g/mol. Its IUPAC name is (E)-3-[3-butoxy-4-[2-(3-chloro-4-ethoxyphenyl)ethoxy]phenyl]-2-ethoxyprop-2-enoic acid.
| Compound Name | (E)-3-[3-butoxy-4-[2-(3-chloro-4-ethoxyphenyl)ethoxy]phenyl]-2-ethoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 68601187 |
| Molecular Formula | C25H31ClO6 |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (E)-3-[3-butoxy-4-[2-(3-chloro-4-ethoxyphenyl)ethoxy]phenyl]-2-ethoxyprop-2-enoic acid |
| SMILES | CCCCOc1cc(/C=C(/OCC)C(=O)O)ccc1OCCc1ccc(OCC)c(Cl)c1 |
| InChI | InChI=1S/C25H31ClO6/c1-4-7-13-31-23-16-19(17-24(25(27)28)30-6-3)9-11-22(23)32-14-12-18-8-10-21(29-5-2)20(26)15-18/h8-11,15-17H,4-7,12-14H2,1-3H3,(H,27,28)/b24-17+ |
| InChIKey | DFQDGKDAOGXBFE-JJIBRWJFSA-N |
| XLogP | 6.00 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|