C26H33ClO8S — CID 87511074
2-ethoxyethyl (Z)-3-[3-butoxy-4-[2-(3-chloro-4-methylsulfonyloxyphenyl)ethoxy]phenyl]prop-2-enoate (PubChem CID 87511074) has the molecular formula C26H33ClO8S and a molecular weight of 541.06 g/mol. Its IUPAC name is 2-ethoxyethyl (Z)-3-[3-butoxy-4-[2-(3-chloro-4-methylsulfonyloxyphenyl)ethoxy]phenyl]prop-2-enoate.
| Compound Name | 2-ethoxyethyl (Z)-3-[3-butoxy-4-[2-(3-chloro-4-methylsulfonyloxyphenyl)ethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 87511074 |
| Molecular Formula | C26H33ClO8S |
| Molecular Weight | 541.06 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 2-ethoxyethyl (Z)-3-[3-butoxy-4-[2-(3-chloro-4-methylsulfonyloxyphenyl)ethoxy]phenyl]prop-2-enoate |
| SMILES | CCCCOc1cc(/C=C\C(=O)OCCOCC)ccc1OCCc1ccc(OS(C)(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C26H33ClO8S/c1-4-6-14-32-25-19-20(9-12-26(28)34-17-16-31-5-2)8-11-24(25)33-15-13-21-7-10-23(22(27)18-21)35-36(3,29)30/h7-12,18-19H,4-6,13-17H2,1-3H3/b12-9- |
| InChIKey | PQCUBULSLMBSOT-XFXZXTDPSA-N |
| XLogP | 5.07 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.06 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|