C25H32O6 — CID 68601181
2-ethoxyethyl (Z)-3-[3-butoxy-4-[2-(4-hydroxyphenyl)ethoxy]phenyl]prop-2-enoate (PubChem CID 68601181) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-ethoxyethyl (Z)-3-[3-butoxy-4-[2-(4-hydroxyphenyl)ethoxy]phenyl]prop-2-enoate.
| Compound Name | 2-ethoxyethyl (Z)-3-[3-butoxy-4-[2-(4-hydroxyphenyl)ethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 68601181 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-ethoxyethyl (Z)-3-[3-butoxy-4-[2-(4-hydroxyphenyl)ethoxy]phenyl]prop-2-enoate |
| SMILES | CCCCOc1cc(/C=C\C(=O)OCCOCC)ccc1OCCc1ccc(O)cc1 |
| InChI | InChI=1S/C25H32O6/c1-3-5-15-29-24-19-21(9-13-25(27)31-18-17-28-4-2)8-12-23(24)30-16-14-20-6-10-22(26)11-7-20/h6-13,19,26H,3-5,14-18H2,1-2H3/b13-9- |
| InChIKey | CWIVJBLVWNWBOP-LCYFTJDESA-N |
| XLogP | 4.79 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|