C29H41NO7S — CID 68598862
2-ethoxyethyl (Z)-3-[3-butoxy-4-[2-[4-(butylsulfonylamino)phenyl]ethoxy]phenyl]prop-2-enoate (PubChem CID 68598862) has the molecular formula C29H41NO7S and a molecular weight of 547.71 g/mol. Its IUPAC name is 2-ethoxyethyl (Z)-3-[3-butoxy-4-[2-[4-(butylsulfonylamino)phenyl]ethoxy]phenyl]prop-2-enoate.
| Compound Name | 2-ethoxyethyl (Z)-3-[3-butoxy-4-[2-[4-(butylsulfonylamino)phenyl]ethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 68598862 |
| Molecular Formula | C29H41NO7S |
| Molecular Weight | 547.71 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | 2-ethoxyethyl (Z)-3-[3-butoxy-4-[2-[4-(butylsulfonylamino)phenyl]ethoxy]phenyl]prop-2-enoate |
| SMILES | CCCCOc1cc(/C=C\C(=O)OCCOCC)ccc1OCCc1ccc(NS(=O)(=O)CCCC)cc1 |
| InChI | InChI=1S/C29H41NO7S/c1-4-7-18-35-28-23-25(12-16-29(31)37-21-20-34-6-3)11-15-27(28)36-19-17-24-9-13-26(14-10-24)30-38(32,33)22-8-5-2/h9-16,23,30H,4-8,17-22H2,1-3H3/b16-12- |
| InChIKey | MGUVWIGINPLYGD-VBKFSLOCSA-N |
| XLogP | 5.62 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.71 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|