C26H34O8S — CID 87511521
2-ethoxyethyl (Z)-3-[4-[2-(4-butylsulfonyloxyphenyl)ethoxy]-3-methoxyphenyl]prop-2-enoate (PubChem CID 87511521) has the molecular formula C26H34O8S and a molecular weight of 506.62 g/mol. Its IUPAC name is 2-ethoxyethyl (Z)-3-[4-[2-(4-butylsulfonyloxyphenyl)ethoxy]-3-methoxyphenyl]prop-2-enoate.
| Compound Name | 2-ethoxyethyl (Z)-3-[4-[2-(4-butylsulfonyloxyphenyl)ethoxy]-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 87511521 |
| Molecular Formula | C26H34O8S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 2-ethoxyethyl (Z)-3-[4-[2-(4-butylsulfonyloxyphenyl)ethoxy]-3-methoxyphenyl]prop-2-enoate |
| SMILES | CCCCS(=O)(=O)Oc1ccc(CCOc2ccc(/C=C\C(=O)OCCOCC)cc2OC)cc1 |
| InChI | InChI=1S/C26H34O8S/c1-4-6-19-35(28,29)34-23-11-7-21(8-12-23)15-16-32-24-13-9-22(20-25(24)30-3)10-14-26(27)33-18-17-31-5-2/h7-14,20H,4-6,15-19H2,1-3H3/b14-10- |
| InChIKey | KOCMVPPVSMWWIE-UVTDQMKNSA-N |
| XLogP | 4.42 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|