C25H31ClO6 — CID 91428034
2-[[3-butoxy-4-[2-(3-chloro-4-hydroxyphenyl)ethoxy]phenyl]methylidene]-4-ethoxybutanoic acid (PubChem CID 91428034) has the molecular formula C25H31ClO6 and a molecular weight of 462.97 g/mol. Its IUPAC name is 2-[[3-butoxy-4-[2-(3-chloro-4-hydroxyphenyl)ethoxy]phenyl]methylidene]-4-ethoxybutanoic acid.
| Compound Name | 2-[[3-butoxy-4-[2-(3-chloro-4-hydroxyphenyl)ethoxy]phenyl]methylidene]-4-ethoxybutanoic acid |
|---|---|
| PubChem CID | 91428034 |
| Molecular Formula | C25H31ClO6 |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-[[3-butoxy-4-[2-(3-chloro-4-hydroxyphenyl)ethoxy]phenyl]methylidene]-4-ethoxybutanoic acid |
| SMILES | CCCCOc1cc(C=C(CCOCC)C(=O)O)ccc1OCCc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C25H31ClO6/c1-3-5-12-31-24-17-19(15-20(25(28)29)11-13-30-4-2)7-9-23(24)32-14-10-18-6-8-22(27)21(26)16-18/h6-9,15-17,27H,3-5,10-14H2,1-2H3,(H,28,29) |
| InChIKey | YLUWUAMHNJVTPI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|