C26H33NO6 — CID 25164457
(Z)-3-[3-butoxy-4-[2-[4-(propanoylamino)phenyl]ethoxy]phenyl]-2-ethoxyprop-2-enoic acid (PubChem CID 25164457) has the molecular formula C26H33NO6 and a molecular weight of 455.55 g/mol. Its IUPAC name is (Z)-3-[3-butoxy-4-[2-[4-(propanoylamino)phenyl]ethoxy]phenyl]-2-ethoxyprop-2-enoic acid.
| Compound Name | (Z)-3-[3-butoxy-4-[2-[4-(propanoylamino)phenyl]ethoxy]phenyl]-2-ethoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 25164457 |
| Molecular Formula | C26H33NO6 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | (Z)-3-[3-butoxy-4-[2-[4-(propanoylamino)phenyl]ethoxy]phenyl]-2-ethoxyprop-2-enoic acid |
| SMILES | CCCCOc1cc(/C=C(\OCC)C(=O)O)ccc1OCCc1ccc(NC(=O)CC)cc1 |
| InChI | InChI=1S/C26H33NO6/c1-4-7-15-32-23-17-20(18-24(26(29)30)31-6-3)10-13-22(23)33-16-14-19-8-11-21(12-9-19)27-25(28)5-2/h8-13,17-18H,4-7,14-16H2,1-3H3,(H,27,28)(H,29,30)/b24-18- |
| InChIKey | OOWUDSXDJINNPR-MOHJPFBDSA-N |
| XLogP | 5.30 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|